C21H21N3O2 — CID 91343706
[1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl] acetate (PubChem CID 91343706) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is [1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl] acetate.
| Compound Name | [1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 91343706 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCN(c2nccc(-c3ccc4ccccc4c3)n2)CC1 |
| InChI | InChI=1S/C21H21N3O2/c1-15(25)26-19-9-12-24(13-10-19)21-22-11-8-20(23-21)18-7-6-16-4-2-3-5-17(16)14-18/h2-8,11,14,19H,9-10,12-13H2,1H3 |
| InChIKey | NQUAPYORZNCHTG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |