C20H23N5O2S — CID 25217829
2-[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]-4-naphthalen-2-ylpyrimidine (PubChem CID 25217829) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]-4-naphthalen-2-ylpyrimidine.
| Compound Name | 2-[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]-4-naphthalen-2-ylpyrimidine |
|---|---|
| PubChem CID | 25217829 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]-4-naphthalen-2-ylpyrimidine |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1CCN(c2nccc(-c3ccc4ccccc4c3)n2)C1 |
| InChI | InChI=1S/C20H23N5O2S/c1-24(2)28(26,27)23-18-10-12-25(14-18)20-21-11-9-19(22-20)17-8-7-15-5-3-4-6-16(15)13-17/h3-9,11,13,18,23H,10,12,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | HOKWMCZMNUPYRW-GOSISDBHSA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |