C26H25N3O3S — CID 87560832
[(3R)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87560832) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is [(3R)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87560832 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | [(3R)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CCN(c3nccc(-c4ccc5ccccc5c4)n3)C2)cc1 |
| InChI | InChI=1S/C26H25N3O3S/c1-19-6-10-24(11-7-19)33(30,31)32-18-20-13-15-29(17-20)26-27-14-12-25(28-26)23-9-8-21-4-2-3-5-22(21)16-23/h2-12,14,16,20H,13,15,17-18H2,1H3/t20-/m1/s1 |
| InChIKey | CNZQESXLTXHINF-HXUWFJFHSA-N |
| XLogP | 4.84 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|