C10H9NO2S — CID 68730980
ethyl thieno[3,2-c]pyridine-3-carboxylate (PubChem CID 68730980) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is ethyl thieno[3,2-c]pyridine-3-carboxylate.
| Compound Name | ethyl thieno[3,2-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68730980 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | ethyl thieno[3,2-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1csc2ccncc12 |
| InChI | InChI=1S/C10H9NO2S/c1-2-13-10(12)8-6-14-9-3-4-11-5-7(8)9/h3-6H,2H2,1H3 |
| InChIKey | BHDPCLDBYIPSJP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |