C14H20F3N3O3S — CID 68731806
2-(butylsulfamoyl)-2-methyl-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 68731806) has the molecular formula C14H20F3N3O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-(butylsulfamoyl)-2-methyl-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | 2-(butylsulfamoyl)-2-methyl-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 68731806 |
| Molecular Formula | C14H20F3N3O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-(butylsulfamoyl)-2-methyl-N-[6-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | CCCCNS(=O)(=O)C(C)(C)C(=O)Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N3O3S/c1-4-5-9-18-24(22,23)13(2,3)12(21)20-11-8-6-7-10(19-11)14(15,16)17/h6-8,18H,4-5,9H2,1-3H3,(H,19,20,21) |
| InChIKey | GJHKYPIOLCVQBL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|