(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid

C21H24O6 — CID 68731850

IUPAC(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid
SMILESCC/C(=C(\C(=O)O)c1ccc(OCOC)cc1)c1ccc(OCOC)cc1
InChIInChI=1S/C21H24O6/c1-4-19(15-5-9-17(10-6-15)26-13-24-2)20(21(22)23)16-7-11-18(12-8-16)27-14-25-3/h5-12H,4,13-14H2,1-3H3,(H,22,23)/b20-19+
InChIKeyFCCLEFXNFAJMPO-FMQUCBEESA-N
MW372.42 g/mol
LogP4.06
Rot. Bonds10

About (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid

(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid (PubChem CID 68731850) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid.

Molecular Properties

Compound Name(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid
PubChem CID68731850
Molecular FormulaC21H24O6
Molecular Weight372.42 g/mol
Exact Mass372.16
IUPAC Name(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid
SMILESCC/C(=C(\C(=O)O)c1ccc(OCOC)cc1)c1ccc(OCOC)cc1
InChIInChI=1S/C21H24O6/c1-4-19(15-5-9-17(10-6-15)26-13-24-2)20(21(22)23)16-7-11-18(12-8-16)27-14-25-3/h5-12H,4,13-14H2,1-3H3,(H,22,23)/b20-19+
InChIKeyFCCLEFXNFAJMPO-FMQUCBEESA-N
XLogP4.06
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.42
LogP ≤ 54.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid?
The IUPAC name of (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid (CID 68731850) is (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid.
What is the SMILES notation for (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid?
The canonical SMILES for (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid is CC/C(=C(\C(=O)O)c1ccc(OCOC)cc1)c1ccc(OCOC)cc1.
What is the InChIKey of (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid?
The InChIKey is FCCLEFXNFAJMPO-FMQUCBEESA-N. The full InChI is InChI=1S/C21H24O6/c1-4-19(15-5-9-17(10-6-15)26-13-24-2)20(21(22)23)16-7-11-18(12-8-16)27-14-25-3/h5-12H,4,13-14H2,1-3H3,(H,22,23)/b20-19+.
What are the key properties of (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid?
(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid has a molecular weight of 372.42 g/mol, XLogP of 4.06, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid is sourced from PubChem (CID 68731850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).