C21H24O6 — CID 68731850
(E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid (PubChem CID 68731850) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid.
| Compound Name | (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 68731850 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (E)-2,3-bis[4-(methoxymethoxy)phenyl]pent-2-enoic acid |
| SMILES | CC/C(=C(\C(=O)O)c1ccc(OCOC)cc1)c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C21H24O6/c1-4-19(15-5-9-17(10-6-15)26-13-24-2)20(21(22)23)16-7-11-18(12-8-16)27-14-25-3/h5-12H,4,13-14H2,1-3H3,(H,22,23)/b20-19+ |
| InChIKey | FCCLEFXNFAJMPO-FMQUCBEESA-N |
| XLogP | 4.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|