C29H31F3IN5O2 — CID 68733537
N-[2-iodo-1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxypyridine-2-carboxamide (PubChem CID 68733537) has the molecular formula C29H31F3IN5O2 and a molecular weight of 665.50 g/mol. Its IUPAC name is N-[2-iodo-1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxypyridine-2-carboxamide.
| Compound Name | N-[2-iodo-1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 68733537 |
| Molecular Formula | C29H31F3IN5O2 |
| Molecular Weight | 665.50 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | N-[2-iodo-1-(pyridin-4-ylmethyl)piperidin-4-yl]-4-[1-[4-(trifluoromethyl)phenyl]piperidin-4-yl]oxypyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccncc2)C(I)C1)c1cc(OC2CCN(c3ccc(C(F)(F)F)cc3)CC2)ccn1 |
| InChI | InChI=1S/C29H31F3IN5O2/c30-29(31,32)21-1-3-23(4-2-21)37-15-9-24(10-16-37)40-25-7-13-35-26(18-25)28(39)36-22-8-14-38(27(33)17-22)19-20-5-11-34-12-6-20/h1-7,11-13,18,22,24,27H,8-10,14-17,19H2,(H,36,39) |
| InChIKey | LAHGIRYBRWXMOD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|