C20H25IN2O3 — CID 68735465
[5-(3,4-dimethylphenyl)-1,2-oxazol-4-yl]-[(3R)-3-(2-hydroxypropan-2-yl)-2-iodopiperidin-1-yl]methanone (PubChem CID 68735465) has the molecular formula C20H25IN2O3 and a molecular weight of 468.34 g/mol. Its IUPAC name is [5-(3,4-dimethylphenyl)-1,2-oxazol-4-yl]-[(3R)-3-(2-hydroxypropan-2-yl)-2-iodopiperidin-1-yl]methanone.
| Compound Name | [5-(3,4-dimethylphenyl)-1,2-oxazol-4-yl]-[(3R)-3-(2-hydroxypropan-2-yl)-2-iodopiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 68735465 |
| Molecular Formula | C20H25IN2O3 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | [5-(3,4-dimethylphenyl)-1,2-oxazol-4-yl]-[(3R)-3-(2-hydroxypropan-2-yl)-2-iodopiperidin-1-yl]methanone |
| SMILES | Cc1ccc(-c2oncc2C(=O)N2CCC[C@H](C(C)(C)O)C2I)cc1C |
| InChI | InChI=1S/C20H25IN2O3/c1-12-7-8-14(10-13(12)2)17-15(11-22-26-17)19(24)23-9-5-6-16(18(23)21)20(3,4)25/h7-8,10-11,16,18,25H,5-6,9H2,1-4H3/t16-,18?/m0/s1 |
| InChIKey | RQJZSUZGNRUTQL-ATNAJCNCSA-N |
| XLogP | 4.34 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|