C17H12Br2N2O2 — CID 68736816
3,3-dibromo-1-[(4-methoxyphenyl)methyl]-2-oxoindole-4-carbonitrile (PubChem CID 68736816) has the molecular formula C17H12Br2N2O2 and a molecular weight of 436.10 g/mol. Its IUPAC name is 3,3-dibromo-1-[(4-methoxyphenyl)methyl]-2-oxoindole-4-carbonitrile.
| Compound Name | 3,3-dibromo-1-[(4-methoxyphenyl)methyl]-2-oxoindole-4-carbonitrile |
|---|---|
| PubChem CID | 68736816 |
| Molecular Formula | C17H12Br2N2O2 |
| Molecular Weight | 436.10 g/mol |
| Exact Mass | 433.93 |
| IUPAC Name | 3,3-dibromo-1-[(4-methoxyphenyl)methyl]-2-oxoindole-4-carbonitrile |
| SMILES | COc1ccc(CN2C(=O)C(Br)(Br)c3c(C#N)cccc32)cc1 |
| InChI | InChI=1S/C17H12Br2N2O2/c1-23-13-7-5-11(6-8-13)10-21-14-4-2-3-12(9-20)15(14)17(18,19)16(21)22/h2-8H,10H2,1H3 |
| InChIKey | DFQPWZNGGIRFBG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|