C19H35O3P — CID 68740938
butyl-(3-butyl-2-tert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphane (PubChem CID 68740938) has the molecular formula C19H35O3P and a molecular weight of 342.46 g/mol. Its IUPAC name is butyl-(3-butyl-2-tert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphane.
| Compound Name | butyl-(3-butyl-2-tert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphane |
|---|---|
| PubChem CID | 68740938 |
| Molecular Formula | C19H35O3P |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | butyl-(3-butyl-2-tert-butyl-4-methylphenyl)-trihydroxy-λ5-phosphane |
| SMILES | CCCCc1c(C)ccc(P(O)(O)(O)CCCC)c1C(C)(C)C |
| InChI | InChI=1S/C19H35O3P/c1-7-9-11-16-15(3)12-13-17(18(16)19(4,5)6)23(20,21,22)14-10-8-2/h12-13,20-22H,7-11,14H2,1-6H3 |
| InChIKey | IIKKOLGJNAHAFH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|