C13H16O4S2 — CID 68742060
2-[(2S)-2-cyclopropyl-2-methylsulfanylethyl]sulfonylbenzoic acid (PubChem CID 68742060) has the molecular formula C13H16O4S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(2S)-2-cyclopropyl-2-methylsulfanylethyl]sulfonylbenzoic acid.
| Compound Name | 2-[(2S)-2-cyclopropyl-2-methylsulfanylethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 68742060 |
| Molecular Formula | C13H16O4S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(2S)-2-cyclopropyl-2-methylsulfanylethyl]sulfonylbenzoic acid |
| SMILES | CS[C@H](CS(=O)(=O)c1ccccc1C(=O)O)C1CC1 |
| InChI | InChI=1S/C13H16O4S2/c1-18-11(9-6-7-9)8-19(16,17)12-5-3-2-4-10(12)13(14)15/h2-5,9,11H,6-8H2,1H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | PZAPNZJXPFXURV-LLVKDONJSA-N |
| XLogP | 2.30 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |