C12H15NOS — CID 68742071
3,4-dimethyl-5-(4-methylphenyl)-1,3-thiazolidin-2-one (PubChem CID 68742071) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 3,4-dimethyl-5-(4-methylphenyl)-1,3-thiazolidin-2-one.
| Compound Name | 3,4-dimethyl-5-(4-methylphenyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 68742071 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3,4-dimethyl-5-(4-methylphenyl)-1,3-thiazolidin-2-one |
| SMILES | Cc1ccc(C2SC(=O)N(C)C2C)cc1 |
| InChI | InChI=1S/C12H15NOS/c1-8-4-6-10(7-5-8)11-9(2)13(3)12(14)15-11/h4-7,9,11H,1-3H3 |
| InChIKey | UKOSTPRDGVDQPM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|