C19H26N2O2S — CID 13284691
(4R,5R)-4-methyl-N-(4-methylcyclohexyl)-5-(4-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide (PubChem CID 13284691) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is (4R,5R)-4-methyl-N-(4-methylcyclohexyl)-5-(4-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide.
| Compound Name | (4R,5R)-4-methyl-N-(4-methylcyclohexyl)-5-(4-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 13284691 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4R,5R)-4-methyl-N-(4-methylcyclohexyl)-5-(4-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide |
| SMILES | Cc1ccc([C@H]2SC(=O)N(C(=O)NC3CCC(C)CC3)[C@@H]2C)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-12-4-8-15(9-5-12)17-14(3)21(19(23)24-17)18(22)20-16-10-6-13(2)7-11-16/h4-5,8-9,13-14,16-17H,6-7,10-11H2,1-3H3,(H,20,22)/t13?,14-,16?,17+/m1/s1 |
| InChIKey | MIPGHOIOZALWKN-CPBWPMLKSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|