C18H24N2O2S — CID 13284628
N-cyclohexyl-4-methyl-5-(3-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide (PubChem CID 13284628) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-5-(3-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-cyclohexyl-4-methyl-5-(3-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 13284628 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-cyclohexyl-4-methyl-5-(3-methylphenyl)-2-oxo-1,3-thiazolidine-3-carboxamide |
| SMILES | Cc1cccc(C2SC(=O)N(C(=O)NC3CCCCC3)C2C)c1 |
| InChI | InChI=1S/C18H24N2O2S/c1-12-7-6-8-14(11-12)16-13(2)20(18(22)23-16)17(21)19-15-9-4-3-5-10-15/h6-8,11,13,15-16H,3-5,9-10H2,1-2H3,(H,19,21) |
| InChIKey | HWCLHAAGMSELHY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|