C18H23ClN2O2S — CID 142139775
5-(4-chlorocyclohepta-1,3,5-trien-1-yl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide (PubChem CID 142139775) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is 5-(4-chlorocyclohepta-1,3,5-trien-1-yl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide.
| Compound Name | 5-(4-chlorocyclohepta-1,3,5-trien-1-yl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 142139775 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-(4-chlorocyclohepta-1,3,5-trien-1-yl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide |
| SMILES | CC1C(C2=CC=C(Cl)C=CC2)SC(=O)N1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H23ClN2O2S/c1-12-16(13-6-5-7-14(19)11-10-13)24-18(23)21(12)17(22)20-15-8-3-2-4-9-15/h5,7,10-12,15-16H,2-4,6,8-9H2,1H3,(H,20,22) |
| InChIKey | NBOMVAIKDZVEGC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|