C18H30O3 — CID 68744252
(4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one (PubChem CID 68744252) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one.
| Compound Name | (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 68744252 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4S)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC(=O)C2C)OCCO1 |
| InChI | InChI=1S/C18H30O3/c1-3-4-5-6-7-11-18(20-13-14-21-18)12-10-16-8-9-17(19)15(16)2/h8-9,15-16H,3-7,10-14H2,1-2H3/t15?,16-/m1/s1 |
| InChIKey | CQHDKPUVJUOFEH-OEMAIJDKSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|