C26H46NO3P — CID 68745469
2-[methyl-[2-(tetrabutyl-λ5-phosphanyl)benzoyl]amino]acetic acid (PubChem CID 68745469) has the molecular formula C26H46NO3P and a molecular weight of 451.63 g/mol. Its IUPAC name is 2-[methyl-[2-(tetrabutyl-λ5-phosphanyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(tetrabutyl-λ5-phosphanyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 68745469 |
| Molecular Formula | C26H46NO3P |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 2-[methyl-[2-(tetrabutyl-λ5-phosphanyl)benzoyl]amino]acetic acid |
| SMILES | CCCCP(CCCC)(CCCC)(CCCC)c1ccccc1C(=O)N(C)CC(=O)O |
| InChI | InChI=1S/C26H46NO3P/c1-6-10-18-31(19-11-7-2,20-12-8-3,21-13-9-4)24-17-15-14-16-23(24)26(30)27(5)22-25(28)29/h14-17H,6-13,18-22H2,1-5H3,(H,28,29) |
| InChIKey | WAJNPGVYLONJSH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|