C11H10Br3NO5S — CID 18717050
2-[methyl-[2-(tribromomethylsulfonyl)benzoyl]amino]acetic acid (PubChem CID 18717050) has the molecular formula C11H10Br3NO5S and a molecular weight of 507.98 g/mol. Its IUPAC name is 2-[methyl-[2-(tribromomethylsulfonyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(tribromomethylsulfonyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18717050 |
| Molecular Formula | C11H10Br3NO5S |
| Molecular Weight | 507.98 g/mol |
| Exact Mass | 504.78 |
| IUPAC Name | 2-[methyl-[2-(tribromomethylsulfonyl)benzoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1ccccc1S(=O)(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C11H10Br3NO5S/c1-15(6-9(16)17)10(18)7-4-2-3-5-8(7)21(19,20)11(12,13)14/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | MZEZYOBGLDQHBF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.98 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|