C12H16F2O2 — CID 68746272
ethyl 3-[(2,2-difluorocyclopropylidene)methyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 68746272) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is ethyl 3-[(2,2-difluorocyclopropylidene)methyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | ethyl 3-[(2,2-difluorocyclopropylidene)methyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 68746272 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | ethyl 3-[(2,2-difluorocyclopropylidene)methyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(C=C2CC2(F)F)C1(C)C |
| InChI | InChI=1S/C12H16F2O2/c1-4-16-10(15)9-8(11(9,2)3)5-7-6-12(7,13)14/h5,8-9H,4,6H2,1-3H3 |
| InChIKey | FKXOOYZIEMXURE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|