C12H17FO4 — CID 68746740
ethyl 3-[(Z)-2-fluoro-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 68746740) has the molecular formula C12H17FO4 and a molecular weight of 244.26 g/mol. Its IUPAC name is ethyl 3-[(Z)-2-fluoro-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | ethyl 3-[(Z)-2-fluoro-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 68746740 |
| Molecular Formula | C12H17FO4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | ethyl 3-[(Z)-2-fluoro-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(/C=C(\F)C(=O)OC)C1(C)C |
| InChI | InChI=1S/C12H17FO4/c1-5-17-11(15)9-7(12(9,2)3)6-8(13)10(14)16-4/h6-7,9H,5H2,1-4H3/b8-6- |
| InChIKey | LEDJLNONTDFRSS-VURMDHGXSA-N |
| XLogP | 1.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|