C11H17NO3 — CID 68747075
7-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylideneheptanoic acid (PubChem CID 68747075) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 7-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylideneheptanoic acid.
| Compound Name | 7-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylideneheptanoic acid |
|---|---|
| PubChem CID | 68747075 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 7-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylideneheptanoic acid |
| SMILES | C=C(CCCCCC1=NCCO1)C(=O)O |
| InChI | InChI=1S/C11H17NO3/c1-9(11(13)14)5-3-2-4-6-10-12-7-8-15-10/h1-8H2,(H,13,14) |
| InChIKey | AUFHOINZAIJXRC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|