C12H20BrNO3 — CID 158341290
5-(4,5-dihydro-1,3-oxazol-2-yl)pentyl 2-bromo-2-methylpropanoate (PubChem CID 158341290) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 5-(4,5-dihydro-1,3-oxazol-2-yl)pentyl 2-bromo-2-methylpropanoate.
| Compound Name | 5-(4,5-dihydro-1,3-oxazol-2-yl)pentyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 158341290 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-(4,5-dihydro-1,3-oxazol-2-yl)pentyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCCCCC1=NCCO1 |
| InChI | InChI=1S/C12H20BrNO3/c1-12(2,13)11(15)17-8-5-3-4-6-10-14-7-9-16-10/h3-9H2,1-2H3 |
| InChIKey | GREQCJZZYVDPRO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|