C21H38N2O4Si — CID 68747143
(5S)-1-oxo-2-(4-triethylsilyloxycyclohexyl)-2,9-diazaspiro[4.5]decane-9-carboxylic acid (PubChem CID 68747143) has the molecular formula C21H38N2O4Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (5S)-1-oxo-2-(4-triethylsilyloxycyclohexyl)-2,9-diazaspiro[4.5]decane-9-carboxylic acid.
| Compound Name | (5S)-1-oxo-2-(4-triethylsilyloxycyclohexyl)-2,9-diazaspiro[4.5]decane-9-carboxylic acid |
|---|---|
| PubChem CID | 68747143 |
| Molecular Formula | C21H38N2O4Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (5S)-1-oxo-2-(4-triethylsilyloxycyclohexyl)-2,9-diazaspiro[4.5]decane-9-carboxylic acid |
| SMILES | CC[Si](CC)(CC)OC1CCC(N2CC[C@]3(CCCN(C(=O)O)C3)C2=O)CC1 |
| InChI | InChI=1S/C21H38N2O4Si/c1-4-28(5-2,6-3)27-18-10-8-17(9-11-18)23-15-13-21(19(23)24)12-7-14-22(16-21)20(25)26/h17-18H,4-16H2,1-3H3,(H,25,26)/t17?,18?,21-/m0/s1 |
| InChIKey | NRILNENTISOEDB-NGICGMGXSA-N |
| XLogP | 4.31 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|