C24H24F3N3O3 — CID 68747811
6-[4-[3-[[3-(trifluoromethoxy)phenyl]methylamino]butyl]phenoxy]pyridine-3-carboxamide (PubChem CID 68747811) has the molecular formula C24H24F3N3O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is 6-[4-[3-[[3-(trifluoromethoxy)phenyl]methylamino]butyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[3-[[3-(trifluoromethoxy)phenyl]methylamino]butyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68747811 |
| Molecular Formula | C24H24F3N3O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 6-[4-[3-[[3-(trifluoromethoxy)phenyl]methylamino]butyl]phenoxy]pyridine-3-carboxamide |
| SMILES | CC(CCc1ccc(Oc2ccc(C(N)=O)cn2)cc1)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H24F3N3O3/c1-16(29-14-18-3-2-4-21(13-18)33-24(25,26)27)5-6-17-7-10-20(11-8-17)32-22-12-9-19(15-30-22)23(28)31/h2-4,7-13,15-16,29H,5-6,14H2,1H3,(H2,28,31) |
| InChIKey | BQQMHXUWDUGJTI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |