C25H34FN7O2Si — CID 68748790
4-[4-(aminomethyl)-4-fluoropiperidin-1-yl]-N-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidin-2-amine (PubChem CID 68748790) has the molecular formula C25H34FN7O2Si and a molecular weight of 511.68 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-4-fluoropiperidin-1-yl]-N-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[4-(aminomethyl)-4-fluoropiperidin-1-yl]-N-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68748790 |
| Molecular Formula | C25H34FN7O2Si |
| Molecular Weight | 511.68 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 4-[4-(aminomethyl)-4-fluoropiperidin-1-yl]-N-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]furo[3,2-d]pyrimidin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1ncc2ccc(Nc3nc(N4CCC(F)(CN)CC4)c4occc4n3)cc21 |
| InChI | InChI=1S/C25H34FN7O2Si/c1-36(2,3)13-12-34-17-33-21-14-19(5-4-18(21)15-28-33)29-24-30-20-6-11-35-22(20)23(31-24)32-9-7-25(26,16-27)8-10-32/h4-6,11,14-15H,7-10,12-13,16-17,27H2,1-3H3,(H,29,30,31) |
| InChIKey | RXXBJRVWKULFMI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|