C26H30BClN2O5 — CID 68750827
2-(2-chlorophenyl)ethyl N-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]carbamate (PubChem CID 68750827) has the molecular formula C26H30BClN2O5 and a molecular weight of 496.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)ethyl N-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]carbamate.
| Compound Name | 2-(2-chlorophenyl)ethyl N-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 68750827 |
| Molecular Formula | C26H30BClN2O5 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-(2-chlorophenyl)ethyl N-[3-methyl-5-[4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]phenyl]-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(CB3OC(C)(C)C(C)(C)O3)cc2)c1NC(=O)OCCc1ccccc1Cl |
| InChI | InChI=1S/C26H30BClN2O5/c1-17-22(29-24(31)32-15-14-19-8-6-7-9-21(19)28)23(33-30-17)20-12-10-18(11-13-20)16-27-34-25(2,3)26(4,5)35-27/h6-13H,14-16H2,1-5H3,(H,29,31) |
| InChIKey | SJPQQMADDACAER-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|