About ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate
ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate (PubChem CID 68753198) has the molecular formula C31H27Br2NO6
and a molecular weight of 669.37 g/mol. Its IUPAC name is ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate |
| PubChem CID | 68753198 |
| Molecular Formula | C31H27Br2NO6 |
| Molecular Weight | 669.37 g/mol |
| Exact Mass | 667.02 |
| IUPAC Name | ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccccc1OC)c1cc(Br)c(Oc2ccc(OC)c(-c3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C31H27Br2NO6/c1-4-39-29(35)19-34(31(36)23-12-8-9-13-27(23)37-2)21-16-25(32)30(26(33)17-21)40-22-14-15-28(38-3)24(18-22)20-10-6-5-7-11-20/h5-18H,4,19H2,1-3H3 |
| InChIKey | MGPINVKQHDMNLW-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 669.37 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate?
The IUPAC name of ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate (CID 68753198) is ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate.
What is the SMILES notation for ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate?
The canonical SMILES for ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate is CCOC(=O)CN(C(=O)c1ccccc1OC)c1cc(Br)c(Oc2ccc(OC)c(-c3ccccc3)c2)c(Br)c1.
What is the InChIKey of ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate?
The InChIKey is MGPINVKQHDMNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27Br2NO6/c1-4-39-29(35)19-34(31(36)23-12-8-9-13-27(23)37-2)21-16-25(32)30(26(33)17-21)40-22-14-15-28(38-3)24(18-22)20-10-6-5-7-11-20/h5-18H,4,19H2,1-3H3.
What are the key properties of ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate?
ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate has a molecular weight of 669.37 g/mol, XLogP of 7.90, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3,5-dibromo-N-(2-methoxybenzoyl)-4-(4-methoxy-3-phenylphenoxy)anilino]acetate is sourced from PubChem (CID 68753198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).