C25H23Br2NO5 — CID 46188073
ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-phenylphenoxy)phenyl]methylideneamino]oxypropanoate (PubChem CID 46188073) has the molecular formula C25H23Br2NO5 and a molecular weight of 577.27 g/mol. Its IUPAC name is ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-phenylphenoxy)phenyl]methylideneamino]oxypropanoate.
| Compound Name | ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-phenylphenoxy)phenyl]methylideneamino]oxypropanoate |
|---|---|
| PubChem CID | 46188073 |
| Molecular Formula | C25H23Br2NO5 |
| Molecular Weight | 577.27 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-phenylphenoxy)phenyl]methylideneamino]oxypropanoate |
| SMILES | CCOC(=O)C(C)O/N=C/c1cc(Br)c(Oc2ccc(OC)c(-c3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C25H23Br2NO5/c1-4-31-25(29)16(2)33-28-15-17-12-21(26)24(22(27)13-17)32-19-10-11-23(30-3)20(14-19)18-8-6-5-7-9-18/h5-16H,4H2,1-3H3/b28-15+ |
| InChIKey | ZJRIUSCKFLMLGD-RWPZCVJISA-N |
| XLogP | 6.98 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.27 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|