C41H34Br2Cl2N2O9 — CID 91367386
[2-[[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dibromophenyl]methylideneamino]oxyacetyl] 2-[[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]methylideneamino]oxypropanoate (PubChem CID 91367386) has the molecular formula C41H34Br2Cl2N2O9 and a molecular weight of 929.44 g/mol. Its IUPAC name is [2-[[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dibromophenyl]methylideneamino]oxyacetyl] 2-[[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]methylideneamino]oxypropanoate.
| Compound Name | [2-[[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dibromophenyl]methylideneamino]oxyacetyl] 2-[[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]methylideneamino]oxypropanoate |
|---|---|
| PubChem CID | 91367386 |
| Molecular Formula | C41H34Br2Cl2N2O9 |
| Molecular Weight | 929.44 g/mol |
| Exact Mass | 926.00 |
| IUPAC Name | [2-[[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dibromophenyl]methylideneamino]oxyacetyl] 2-[[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]methylideneamino]oxypropanoate |
| SMILES | CC(ON=Cc1cc(Cl)c(Oc2ccc(O)c(C(C)C)c2)c(Cl)c1)C(=O)OC(=O)CON=Cc1cc(Br)c(Oc2ccc(O)c(Cc3ccccc3)c2)c(Br)c1 |
| InChI | InChI=1S/C41H34Br2Cl2N2O9/c1-23(2)31-19-30(10-12-37(31)49)54-40-34(44)16-27(17-35(40)45)21-47-56-24(3)41(51)55-38(50)22-52-46-20-26-14-32(42)39(33(43)15-26)53-29-9-11-36(48)28(18-29)13-25-7-5-4-6-8-25/h4-12,14-21,23-24,48-49H,13,22H2,1-3H3 |
| InChIKey | ZKZPFPCAANZCHY-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 145.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.44 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|