C23H19Br2NO7S — CID 87347864
2-[(Z)-[3,5-dibromo-4-[4-hydroxy-3-(4-methylphenyl)sulfonylphenoxy]phenyl]methylideneamino]oxypropanoic acid (PubChem CID 87347864) has the molecular formula C23H19Br2NO7S and a molecular weight of 613.28 g/mol. Its IUPAC name is 2-[(Z)-[3,5-dibromo-4-[4-hydroxy-3-(4-methylphenyl)sulfonylphenoxy]phenyl]methylideneamino]oxypropanoic acid.
| Compound Name | 2-[(Z)-[3,5-dibromo-4-[4-hydroxy-3-(4-methylphenyl)sulfonylphenoxy]phenyl]methylideneamino]oxypropanoic acid |
|---|---|
| PubChem CID | 87347864 |
| Molecular Formula | C23H19Br2NO7S |
| Molecular Weight | 613.28 g/mol |
| Exact Mass | 610.92 |
| IUPAC Name | 2-[(Z)-[3,5-dibromo-4-[4-hydroxy-3-(4-methylphenyl)sulfonylphenoxy]phenyl]methylideneamino]oxypropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(Oc3c(Br)cc(/C=N\OC(C)C(=O)O)cc3Br)ccc2O)cc1 |
| InChI | InChI=1S/C23H19Br2NO7S/c1-13-3-6-17(7-4-13)34(30,31)21-11-16(5-8-20(21)27)32-22-18(24)9-15(10-19(22)25)12-26-33-14(2)23(28)29/h3-12,14,27H,1-2H3,(H,28,29)/b26-12- |
| InChIKey | RNNPLLNYEGMJEE-ZRGSRPPYSA-N |
| XLogP | 5.67 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.28 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|