C24H28Br2N2O7S — CID 46188789
ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-piperidin-1-ylsulfonylphenoxy)phenyl]methylideneamino]oxypropanoate (PubChem CID 46188789) has the molecular formula C24H28Br2N2O7S and a molecular weight of 648.37 g/mol. Its IUPAC name is ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-piperidin-1-ylsulfonylphenoxy)phenyl]methylideneamino]oxypropanoate.
| Compound Name | ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-piperidin-1-ylsulfonylphenoxy)phenyl]methylideneamino]oxypropanoate |
|---|---|
| PubChem CID | 46188789 |
| Molecular Formula | C24H28Br2N2O7S |
| Molecular Weight | 648.37 g/mol |
| Exact Mass | 646.00 |
| IUPAC Name | ethyl 2-[(E)-[3,5-dibromo-4-(4-methoxy-3-piperidin-1-ylsulfonylphenoxy)phenyl]methylideneamino]oxypropanoate |
| SMILES | CCOC(=O)C(C)O/N=C/c1cc(Br)c(Oc2ccc(OC)c(S(=O)(=O)N3CCCCC3)c2)c(Br)c1 |
| InChI | InChI=1S/C24H28Br2N2O7S/c1-4-33-24(29)16(2)35-27-15-17-12-19(25)23(20(26)13-17)34-18-8-9-21(32-3)22(14-18)36(30,31)28-10-6-5-7-11-28/h8-9,12-16H,4-7,10-11H2,1-3H3/b27-15+ |
| InChIKey | JIUCPQJMKLZFGY-JFLMPSFJSA-N |
| XLogP | 5.49 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|