C20H28O5 — CID 68758050
2-[4-(4-butoxyphenyl)but-3-en-2-yl]-2-propan-2-ylpropanedioic acid (PubChem CID 68758050) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)but-3-en-2-yl]-2-propan-2-ylpropanedioic acid.
| Compound Name | 2-[4-(4-butoxyphenyl)but-3-en-2-yl]-2-propan-2-ylpropanedioic acid |
|---|---|
| PubChem CID | 68758050 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)but-3-en-2-yl]-2-propan-2-ylpropanedioic acid |
| SMILES | CCCCOc1ccc(C=CC(C)C(C(=O)O)(C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C20H28O5/c1-5-6-13-25-17-11-9-16(10-12-17)8-7-15(4)20(14(2)3,18(21)22)19(23)24/h7-12,14-15H,5-6,13H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | ULUAXMQVDRWSJG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|