About CID 68759988
CID 68759988 (PubChem CID 68759988) has the molecular formula C28H28F3N11NaO2S
and a molecular weight of 662.66 g/mol.
Molecular Properties
| Compound Name | CID 68759988 |
| PubChem CID | 68759988 |
| Molecular Formula | C28H28F3N11NaO2S |
| Molecular Weight | 662.66 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1CCC(c2nc(C3=NOC(c4cccc(-n5cncn5)c4)C3)cs2)CC1.[Na].c1nc[nH]n1 |
| InChI | InChI=1S/C26H25F3N8O2S.C2H3N3.Na/c1-16-9-23(26(27,28)29)33-36(16)12-24(38)35-7-5-17(6-8-35)25-32-21(13-40-25)20-11-22(39-34-20)18-3-2-4-19(10-18)37-15-30-14-31-37;1-3-2-5-4-1;/h2-4,9-10,13-15,17,22H,5-8,11-12H2,1H3;1-2H,(H,3,4,5); |
| InChIKey | SBQMUSBCNPERPR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze CID 68759988 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68759988?
The IUPAC name of CID 68759988 (CID 68759988) is not available.
What is the SMILES notation for CID 68759988?
The canonical SMILES for CID 68759988 is Cc1cc(C(F)(F)F)nn1CC(=O)N1CCC(c2nc(C3=NOC(c4cccc(-n5cncn5)c4)C3)cs2)CC1.[Na].c1nc[nH]n1.
What is the InChIKey of CID 68759988?
The InChIKey is SBQMUSBCNPERPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25F3N8O2S.C2H3N3.Na/c1-16-9-23(26(27,28)29)33-36(16)12-24(38)35-7-5-17(6-8-35)25-32-21(13-40-25)20-11-22(39-34-20)18-3-2-4-19(10-18)37-15-30-14-31-37;1-3-2-5-4-1;/h2-4,9-10,13-15,17,22H,5-8,11-12H2,1H3;1-2H,(H,3,4,5);.
What are the key properties of CID 68759988?
CID 68759988 has a molecular weight of 662.66 g/mol, XLogP of 3.94, 6 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68759988 is sourced from PubChem (CID 68759988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).