C27H30F3N5O5S — CID 68744134
2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[(5R)-5-(2,4,6-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 68744134) has the molecular formula C27H30F3N5O5S and a molecular weight of 593.63 g/mol. Its IUPAC name is 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[(5R)-5-(2,4,6-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[(5R)-5-(2,4,6-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 68744134 |
| Molecular Formula | C27H30F3N5O5S |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[(5R)-5-(2,4,6-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | COc1cc(OC)c([C@H]2CC(c3csc(C4CCN(C(=O)Cn5nc(C(F)(F)F)cc5C)CC4)n3)=NO2)c(OC)c1 |
| InChI | InChI=1S/C27H30F3N5O5S/c1-15-9-23(27(28,29)30)32-35(15)13-24(36)34-7-5-16(6-8-34)26-31-19(14-41-26)18-12-22(40-33-18)25-20(38-3)10-17(37-2)11-21(25)39-4/h9-11,14,16,22H,5-8,12-13H2,1-4H3/t22-/m1/s1 |
| InChIKey | VRFDJVDIZBADRD-JOCHJYFZSA-N |
| XLogP | 4.96 |
| TPSA | 100.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |