C27H30F3N5O2S — CID 91159287
2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 91159287) has the molecular formula C27H30F3N5O2S and a molecular weight of 545.63 g/mol. Its IUPAC name is 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91159287 |
| Molecular Formula | C27H30F3N5O2S |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-1-[4-[4-[5-(2,4,6-trimethylphenyl)-2,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | Cc1cc(C)c(C2C=C(c3csc(C4CCN(C(=O)Cn5nc(C(F)(F)F)cc5C)CC4)n3)NO2)c(C)c1 |
| InChI | InChI=1S/C27H30F3N5O2S/c1-15-9-16(2)25(17(3)10-15)22-12-20(33-37-22)21-14-38-26(31-21)19-5-7-34(8-6-19)24(36)13-35-18(4)11-23(32-35)27(28,29)30/h9-12,14,19,22,33H,5-8,13H2,1-4H3 |
| InChIKey | GQHQVJJLICKCBW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |