C11H10N2O2 — CID 68760061
2-(7-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 68760061) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(7-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | 2-(7-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 68760061 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(7-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1cccc2c(C(=O)C(N)=O)c[nH]c12 |
| InChI | InChI=1S/C11H10N2O2/c1-6-3-2-4-7-8(5-13-9(6)7)10(14)11(12)15/h2-5,13H,1H3,(H2,12,15) |
| InChIKey | IHRITFMIOQRFPU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|