C19H17N3O3 — CID 176514152
8-methyl-N'-(4-methylbenzoyl)-4-oxo-1H-quinoline-3-carbohydrazide (PubChem CID 176514152) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 8-methyl-N'-(4-methylbenzoyl)-4-oxo-1H-quinoline-3-carbohydrazide.
| Compound Name | 8-methyl-N'-(4-methylbenzoyl)-4-oxo-1H-quinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 176514152 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 8-methyl-N'-(4-methylbenzoyl)-4-oxo-1H-quinoline-3-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2c[nH]c3c(C)cccc3c2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-11-6-8-13(9-7-11)18(24)21-22-19(25)15-10-20-16-12(2)4-3-5-14(16)17(15)23/h3-10H,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | KNCRLYWCNLAXLE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|