C18H22INO4 — CID 68761228
5-ethyl-1-(1-hydroxy-3,3-dimethylbutan-2-yl)-6-iodo-4-oxoquinoline-3-carboxylic acid (PubChem CID 68761228) has the molecular formula C18H22INO4 and a molecular weight of 443.28 g/mol. Its IUPAC name is 5-ethyl-1-(1-hydroxy-3,3-dimethylbutan-2-yl)-6-iodo-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-ethyl-1-(1-hydroxy-3,3-dimethylbutan-2-yl)-6-iodo-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 68761228 |
| Molecular Formula | C18H22INO4 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 5-ethyl-1-(1-hydroxy-3,3-dimethylbutan-2-yl)-6-iodo-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCc1c(I)ccc2c1c(=O)c(C(=O)O)cn2C(CO)C(C)(C)C |
| InChI | InChI=1S/C18H22INO4/c1-5-10-12(19)6-7-13-15(10)16(22)11(17(23)24)8-20(13)14(9-21)18(2,3)4/h6-8,14,21H,5,9H2,1-4H3,(H,23,24) |
| InChIKey | KYCBQNRSOFNFAP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|