C19H18F3N5 — CID 68761295
4-(aminomethyl)-N-(1-pyridin-2-ylethyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 68761295) has the molecular formula C19H18F3N5 and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-pyridin-2-ylethyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(aminomethyl)-N-(1-pyridin-2-ylethyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68761295 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(aminomethyl)-N-(1-pyridin-2-ylethyl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | CC(Nc1nc(CN)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccn1 |
| InChI | InChI=1S/C19H18F3N5/c1-12(16-4-2-3-9-24-16)25-18-26-15(11-23)10-17(27-18)13-5-7-14(8-6-13)19(20,21)22/h2-10,12H,11,23H2,1H3,(H,25,26,27) |
| InChIKey | REWVWRAKJHVLJP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |