C16H25N3O4 — CID 68761500
tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;1H-pyrrole-2-carboxylic acid (PubChem CID 68761500) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;1H-pyrrole-2-carboxylic acid.
| Compound Name | tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 68761500 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;1H-pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC2CNCC2C1.O=C(O)c1ccc[nH]1 |
| InChI | InChI=1S/C11H20N2O2.C5H5NO2/c1-11(2,3)15-10(14)13-6-8-4-12-5-9(8)7-13;7-5(8)4-2-1-3-6-4/h8-9,12H,4-7H2,1-3H3;1-3,6H,(H,7,8) |
| InChIKey | ZRMQGXMKRCLCIT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |