C19H26N2O4S — CID 68762056
[5-(4-ethylphenyl)-1-(thiomorpholine-4-carbonyl)piperidin-3-yl] hydrogen carbonate (PubChem CID 68762056) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [5-(4-ethylphenyl)-1-(thiomorpholine-4-carbonyl)piperidin-3-yl] hydrogen carbonate.
| Compound Name | [5-(4-ethylphenyl)-1-(thiomorpholine-4-carbonyl)piperidin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68762056 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [5-(4-ethylphenyl)-1-(thiomorpholine-4-carbonyl)piperidin-3-yl] hydrogen carbonate |
| SMILES | CCc1ccc(C2CC(OC(=O)O)CN(C(=O)N3CCSCC3)C2)cc1 |
| InChI | InChI=1S/C19H26N2O4S/c1-2-14-3-5-15(6-4-14)16-11-17(25-19(23)24)13-21(12-16)18(22)20-7-9-26-10-8-20/h3-6,16-17H,2,7-13H2,1H3,(H,23,24) |
| InChIKey | OVKCOTJPGGWTTJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |