C20H27NO4 — CID 66701395
[1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)piperidin-3-yl] hydrogen carbonate (PubChem CID 66701395) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)piperidin-3-yl] hydrogen carbonate.
| Compound Name | [1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)piperidin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 66701395 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)piperidin-3-yl] hydrogen carbonate |
| SMILES | CCc1ccc(C2CC(OC(=O)O)CN(C(=O)C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-2-14-7-9-15(10-8-14)17-11-18(25-20(23)24)13-21(12-17)19(22)16-5-3-4-6-16/h7-10,16-18H,2-6,11-13H2,1H3,(H,23,24) |
| InChIKey | STNCTBBMHRFEGV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |