C30H37FN2O2 — CID 143810858
methyl 1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)-N-[3-(4-fluorophenyl)prop-1-en-2-yl]piperidine-3-carboximidate (PubChem CID 143810858) has the molecular formula C30H37FN2O2 and a molecular weight of 476.64 g/mol. Its IUPAC name is methyl 1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)-N-[3-(4-fluorophenyl)prop-1-en-2-yl]piperidine-3-carboximidate.
| Compound Name | methyl 1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)-N-[3-(4-fluorophenyl)prop-1-en-2-yl]piperidine-3-carboximidate |
|---|---|
| PubChem CID | 143810858 |
| Molecular Formula | C30H37FN2O2 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | methyl 1-(cyclopentanecarbonyl)-5-(4-ethylphenyl)-N-[3-(4-fluorophenyl)prop-1-en-2-yl]piperidine-3-carboximidate |
| SMILES | C=C(Cc1ccc(F)cc1)/N=C(\OC)C1CC(c2ccc(CC)cc2)CN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C30H37FN2O2/c1-4-22-9-13-24(14-10-22)26-18-27(20-33(19-26)30(34)25-7-5-6-8-25)29(35-3)32-21(2)17-23-11-15-28(31)16-12-23/h9-16,25-27H,2,4-8,17-20H2,1,3H3/b32-29- |
| InChIKey | JIAJBXXJAIXUAR-OVXWJCGASA-N |
| XLogP | 6.31 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|