C22H19FN2O3 — CID 68763008
methyl 3-[4-(3-cyclopropyloxyphenyl)-2-fluoroanilino]pyridine-4-carboxylate (PubChem CID 68763008) has the molecular formula C22H19FN2O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is methyl 3-[4-(3-cyclopropyloxyphenyl)-2-fluoroanilino]pyridine-4-carboxylate.
| Compound Name | methyl 3-[4-(3-cyclopropyloxyphenyl)-2-fluoroanilino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 68763008 |
| Molecular Formula | C22H19FN2O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | methyl 3-[4-(3-cyclopropyloxyphenyl)-2-fluoroanilino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccncc1Nc1ccc(-c2cccc(OC3CC3)c2)cc1F |
| InChI | InChI=1S/C22H19FN2O3/c1-27-22(26)18-9-10-24-13-21(18)25-20-8-5-15(12-19(20)23)14-3-2-4-17(11-14)28-16-6-7-16/h2-5,8-13,16,25H,6-7H2,1H3 |
| InChIKey | BLDVVLGWZJBWEU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |