C19H14FLiN2O3 — CID 24987185
lithium 3-[2-fluoro-4-(3-methoxyphenyl)anilino]pyridine-4-carboxylate (PubChem CID 24987185) has the molecular formula C19H14FLiN2O3 and a molecular weight of 344.27 g/mol. Its IUPAC name is lithium 3-[2-fluoro-4-(3-methoxyphenyl)anilino]pyridine-4-carboxylate.
| Compound Name | lithium 3-[2-fluoro-4-(3-methoxyphenyl)anilino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 24987185 |
| Molecular Formula | C19H14FLiN2O3 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | lithium 3-[2-fluoro-4-(3-methoxyphenyl)anilino]pyridine-4-carboxylate |
| SMILES | COc1cccc(-c2ccc(Nc3cnccc3C(=O)[O-])c(F)c2)c1.[Li+] |
| InChI | InChI=1S/C19H15FN2O3.Li/c1-25-14-4-2-3-12(9-14)13-5-6-17(16(20)10-13)22-18-11-21-8-7-15(18)19(23)24;/h2-11,22H,1H3,(H,23,24);/q;+1/p-1 |
| InChIKey | IEWDRGIVUUIUNV-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |