C30H27FN2O2S — CID 68763109
9-(benzenesulfonyl)-6-[2-(3-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole (PubChem CID 68763109) has the molecular formula C30H27FN2O2S and a molecular weight of 498.62 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-6-[2-(3-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole.
| Compound Name | 9-(benzenesulfonyl)-6-[2-(3-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 68763109 |
| Molecular Formula | C30H27FN2O2S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 9-(benzenesulfonyl)-6-[2-(3-fluorophenyl)ethenyl]-4-pentylpyrido[2,3-b]indole |
| SMILES | CCCCCc1ccnc2c1c1cc(C=Cc3cccc(F)c3)ccc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H27FN2O2S/c1-2-3-5-10-24-18-19-32-30-29(24)27-21-23(15-14-22-9-8-11-25(31)20-22)16-17-28(27)33(30)36(34,35)26-12-6-4-7-13-26/h4,6-9,11-21H,2-3,5,10H2,1H3 |
| InChIKey | DFBQYQUNCQWFOO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|