C16H30N+ — CID 68771461
trimethyl-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium (PubChem CID 68771461) has the molecular formula C16H30N+ and a molecular weight of 236.42 g/mol. Its IUPAC name is trimethyl-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium.
| Compound Name | trimethyl-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
|---|---|
| PubChem CID | 68771461 |
| Molecular Formula | C16H30N+ |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.24 |
| IUPAC Name | trimethyl-[2-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]azanium |
| SMILES | C=CC(C)(C1C(C)=CCCC1(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C16H30N/c1-9-16(5,17(6,7)8)14-13(2)11-10-12-15(14,3)4/h9,11,14H,1,10,12H2,2-8H3/q+1 |
| InChIKey | HXKDKNBTWVNTCV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|