C27H43NO5 — CID 68771810
N,N-dihexyl-2-(2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl)acetamide (PubChem CID 68771810) has the molecular formula C27H43NO5 and a molecular weight of 461.64 g/mol. Its IUPAC name is N,N-dihexyl-2-(2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl)acetamide.
| Compound Name | N,N-dihexyl-2-(2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl)acetamide |
|---|---|
| PubChem CID | 68771810 |
| Molecular Formula | C27H43NO5 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | N,N-dihexyl-2-(2-hydroxy-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl)acetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CC1CC(O)CC2(CCC3(C=CC(=O)C=C3)O2)O1 |
| InChI | InChI=1S/C27H43NO5/c1-3-5-7-9-17-28(18-10-8-6-4-2)25(31)20-24-19-23(30)21-27(32-24)16-15-26(33-27)13-11-22(29)12-14-26/h11-14,23-24,30H,3-10,15-21H2,1-2H3 |
| InChIKey | CEMCRRRLXKGVAK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|