C15H22O4 — CID 68772770
methyl (7S,10S)-7-acetyloxy-9-methylspiro[4.5]dec-8-ene-10-carboxylate (PubChem CID 68772770) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (7S,10S)-7-acetyloxy-9-methylspiro[4.5]dec-8-ene-10-carboxylate.
| Compound Name | methyl (7S,10S)-7-acetyloxy-9-methylspiro[4.5]dec-8-ene-10-carboxylate |
|---|---|
| PubChem CID | 68772770 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (7S,10S)-7-acetyloxy-9-methylspiro[4.5]dec-8-ene-10-carboxylate |
| SMILES | COC(=O)[C@@H]1C(C)=C[C@@H](OC(C)=O)CC12CCCC2 |
| InChI | InChI=1S/C15H22O4/c1-10-8-12(19-11(2)16)9-15(6-4-5-7-15)13(10)14(17)18-3/h8,12-13H,4-7,9H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | MZUSXMHSYSJLLN-OLZOCXBDSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|