C17H23ClF2N2O2 — CID 68772863
4-(4-amino-2-fluorobut-2-enoxy)-N-cyclohexyl-3-fluorobenzamide;hydrochloride (PubChem CID 68772863) has the molecular formula C17H23ClF2N2O2 and a molecular weight of 360.83 g/mol. Its IUPAC name is 4-(4-amino-2-fluorobut-2-enoxy)-N-cyclohexyl-3-fluorobenzamide;hydrochloride.
| Compound Name | 4-(4-amino-2-fluorobut-2-enoxy)-N-cyclohexyl-3-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 68772863 |
| Molecular Formula | C17H23ClF2N2O2 |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-(4-amino-2-fluorobut-2-enoxy)-N-cyclohexyl-3-fluorobenzamide;hydrochloride |
| SMILES | Cl.NCC=C(F)COc1ccc(C(=O)NC2CCCCC2)cc1F |
| InChI | InChI=1S/C17H22F2N2O2.ClH/c18-13(8-9-20)11-23-16-7-6-12(10-15(16)19)17(22)21-14-4-2-1-3-5-14;/h6-8,10,14H,1-5,9,11,20H2,(H,21,22);1H |
| InChIKey | QHTFPIZHVXWLGD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |